C11H13N3S — CID 10331030
4a-methyl-2,3,4,5-tetrahydropyrimido[1,6-a]benzimidazole-1-thione (PubChem CID 10331030) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 4a-methyl-2,3,4,5-tetrahydropyrimido[1,6-a]benzimidazole-1-thione.
| Compound Name | 4a-methyl-2,3,4,5-tetrahydropyrimido[1,6-a]benzimidazole-1-thione |
|---|---|
| PubChem CID | 10331030 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4a-methyl-2,3,4,5-tetrahydropyrimido[1,6-a]benzimidazole-1-thione |
| SMILES | CC12CCNC(=S)N1c1ccccc1N2 |
| InChI | InChI=1S/C11H13N3S/c1-11-6-7-12-10(15)14(11)9-5-3-2-4-8(9)13-11/h2-5,13H,6-7H2,1H3,(H,12,15) |
| InChIKey | XGRAXYGWOZAFDP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|