C14H11+ — CID 136803869
2-methylidene-1,3-dihydrophenalen-3-ylium (PubChem CID 136803869) has the molecular formula C14H11+ and a molecular weight of 179.24 g/mol. Its IUPAC name is 2-methylidene-1,3-dihydrophenalen-3-ylium.
| Compound Name | 2-methylidene-1,3-dihydrophenalen-3-ylium |
|---|---|
| PubChem CID | 136803869 |
| Molecular Formula | C14H11+ |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-methylidene-1,3-dihydrophenalen-3-ylium |
| SMILES | C=C1[CH+]c2cccc3cccc(c23)C1 |
| InChI | InChI=1S/C14H11/c1-10-8-12-6-2-4-11-5-3-7-13(9-10)14(11)12/h2-8H,1,9H2/q+1 |
| InChIKey | LQVVURAQESRTOA-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|