C19H21F3IN3O2 — CID 111812917
2-[[2-(cyclopropylmethoxy)phenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide (PubChem CID 111812917) has the molecular formula C19H21F3IN3O2 and a molecular weight of 507.29 g/mol. Its IUPAC name is 2-[[2-(cyclopropylmethoxy)phenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide.
| Compound Name | 2-[[2-(cyclopropylmethoxy)phenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111812917 |
| Molecular Formula | C19H21F3IN3O2 |
| Molecular Weight | 507.29 g/mol |
| Exact Mass | 507.06 |
| IUPAC Name | 2-[[2-(cyclopropylmethoxy)phenyl]methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccc1OCC1CC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F3N3O2.HI/c20-19(21,22)27-16-9-7-15(8-10-16)25-18(23)24-11-14-3-1-2-4-17(14)26-12-13-5-6-13;/h1-4,7-10,13H,5-6,11-12H2,(H3,23,24,25);1H |
| InChIKey | LZVGGHVDMKTMQO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.29 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|