C19H25N5O3 — CID 120972845
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]guanidine (PubChem CID 120972845) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 120972845 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxolan-3-yl]methyl]guanidine |
| SMILES | Cn1nccc1[C@@H]1OCC[C@H]1C/N=C(\N)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H25N5O3/c1-24-15(5-7-22-24)18-13(6-10-27-18)12-21-19(20)23-14-3-4-16-17(11-14)26-9-2-8-25-16/h3-5,7,11,13,18H,2,6,8-10,12H2,1H3,(H3,20,21,23)/t13-,18+/m0/s1 |
| InChIKey | JWDKIZCGIPWBKI-SCLBCKFNSA-N |
| XLogP | 2.09 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|