C18H26IN3O3 — CID 120671792
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-prop-1-en-2-yloxolan-3-yl)methyl]guanidine;hydroiodide (PubChem CID 120671792) has the molecular formula C18H26IN3O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-prop-1-en-2-yloxolan-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-prop-1-en-2-yloxolan-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 120671792 |
| Molecular Formula | C18H26IN3O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[(2-prop-1-en-2-yloxolan-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C=C(C)C1OCCC1C/N=C(\N)Nc1ccc2c(c1)OCCCO2.I |
| InChI | InChI=1S/C18H25N3O3.HI/c1-12(2)17-13(6-9-24-17)11-20-18(19)21-14-4-5-15-16(10-14)23-8-3-7-22-15;/h4-5,10,13,17H,1,3,6-9,11H2,2H3,(H3,19,20,21);1H |
| InChIKey | KERNLGPBPZSLGL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|