C8H15Cl2N3O — CID 86775431
(2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-amine;dihydrochloride (PubChem CID 86775431) has the molecular formula C8H15Cl2N3O and a molecular weight of 240.13 g/mol. Its IUPAC name is (2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-amine;dihydrochloride.
| Compound Name | (2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 86775431 |
| Molecular Formula | C8H15Cl2N3O |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | (2R,3S)-2-(1-methylpyrazol-4-yl)oxolan-3-amine;dihydrochloride |
| SMILES | Cl.Cl.Cn1cc([C@H]2OCC[C@@H]2N)cn1 |
| InChI | InChI=1S/C8H13N3O.2ClH/c1-11-5-6(4-10-11)8-7(9)2-3-12-8;;/h4-5,7-8H,2-3,9H2,1H3;2*1H/t7-,8+;;/m0../s1 |
| InChIKey | CLNAEIWBJREGGX-OXOJUWDDSA-N |
| XLogP | 1.05 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |