C13H28IN3O2S — CID 111812137
N'-(2-tert-butylsulfonylethyl)-3-methylpiperidine-1-carboximidamide;hydroiodide (PubChem CID 111812137) has the molecular formula C13H28IN3O2S and a molecular weight of 417.36 g/mol. Its IUPAC name is N'-(2-tert-butylsulfonylethyl)-3-methylpiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-(2-tert-butylsulfonylethyl)-3-methylpiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111812137 |
| Molecular Formula | C13H28IN3O2S |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | N'-(2-tert-butylsulfonylethyl)-3-methylpiperidine-1-carboximidamide;hydroiodide |
| SMILES | CC1CCCN(/C(N)=N/CCS(=O)(=O)C(C)(C)C)C1.I |
| InChI | InChI=1S/C13H27N3O2S.HI/c1-11-6-5-8-16(10-11)12(14)15-7-9-19(17,18)13(2,3)4;/h11H,5-10H2,1-4H3,(H2,14,15);1H |
| InChIKey | HKWFMXBZKRJHSW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|