C14H21N3 — CID 111073415
2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-butylguanidine (PubChem CID 111073415) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-butylguanidine.
| Compound Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-butylguanidine |
|---|---|
| PubChem CID | 111073415 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-1-butylguanidine |
| SMILES | CCCCN/C(N)=N/CC1Cc2ccccc21 |
| InChI | InChI=1S/C14H21N3/c1-2-3-8-16-14(15)17-10-12-9-11-6-4-5-7-13(11)12/h4-7,12H,2-3,8-10H2,1H3,(H3,15,16,17) |
| InChIKey | RIILPNWUSARAPO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|