C17H28IN3O — CID 110062160
1-butyl-2-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]guanidine;hydroiodide (PubChem CID 110062160) has the molecular formula C17H28IN3O and a molecular weight of 417.34 g/mol. Its IUPAC name is 1-butyl-2-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-2-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110062160 |
| Molecular Formula | C17H28IN3O |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 1-butyl-2-[(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(N)=N/CC1CCCc2cc(OC)ccc21.I |
| InChI | InChI=1S/C17H27N3O.HI/c1-3-4-10-19-17(18)20-12-14-7-5-6-13-11-15(21-2)8-9-16(13)14;/h8-9,11,14H,3-7,10,12H2,1-2H3,(H3,18,19,20);1H |
| InChIKey | PEKHCCUUOYQRIZ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|