C16H23N3O — CID 119120023
1-(2,3-dihydro-1H-inden-5-yl)-2-(oxan-2-ylmethyl)guanidine (PubChem CID 119120023) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-(oxan-2-ylmethyl)guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(oxan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119120023 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(oxan-2-ylmethyl)guanidine |
| SMILES | N/C(=N\CC1CCCCO1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H23N3O/c17-16(18-11-15-6-1-2-9-20-15)19-14-8-7-12-4-3-5-13(12)10-14/h7-8,10,15H,1-6,9,11H2,(H3,17,18,19) |
| InChIKey | RRDXWBFMPCPGBI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|