C20H24IN3 — CID 111810583
1-(2,3-dihydro-1H-inden-5-yl)-2-[(2-phenylcyclopropyl)methyl]guanidine;hydroiodide (PubChem CID 111810583) has the molecular formula C20H24IN3 and a molecular weight of 433.34 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[(2-phenylcyclopropyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(2-phenylcyclopropyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111810583 |
| Molecular Formula | C20H24IN3 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(2-phenylcyclopropyl)methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CC1c1ccccc1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H23N3.HI/c21-20(23-18-10-9-14-7-4-8-16(14)11-18)22-13-17-12-19(17)15-5-2-1-3-6-15;/h1-3,5-6,9-11,17,19H,4,7-8,12-13H2,(H3,21,22,23);1H |
| InChIKey | XBNOAPCFLOGIIW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|