C20H25N3 — CID 111810562
2-[(2-phenylcyclopropyl)methyl]-1-(3-propan-2-ylphenyl)guanidine (PubChem CID 111810562) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-[(2-phenylcyclopropyl)methyl]-1-(3-propan-2-ylphenyl)guanidine.
| Compound Name | 2-[(2-phenylcyclopropyl)methyl]-1-(3-propan-2-ylphenyl)guanidine |
|---|---|
| PubChem CID | 111810562 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 2-[(2-phenylcyclopropyl)methyl]-1-(3-propan-2-ylphenyl)guanidine |
| SMILES | CC(C)c1cccc(N/C(N)=N/CC2CC2c2ccccc2)c1 |
| InChI | InChI=1S/C20H25N3/c1-14(2)16-9-6-10-18(11-16)23-20(21)22-13-17-12-19(17)15-7-4-3-5-8-15/h3-11,14,17,19H,12-13H2,1-2H3,(H3,21,22,23) |
| InChIKey | CHKNDKFBEDOZQN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|