C15H24IN3 — CID 120671972
2-[(1R,2R)-2-ethylcyclopropyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide (PubChem CID 120671972) has the molecular formula C15H24IN3 and a molecular weight of 373.28 g/mol. Its IUPAC name is 2-[(1R,2R)-2-ethylcyclopropyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(1R,2R)-2-ethylcyclopropyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120671972 |
| Molecular Formula | C15H24IN3 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 2-[(1R,2R)-2-ethylcyclopropyl]-1-(3-propan-2-ylphenyl)guanidine;hydroiodide |
| SMILES | CC[C@@H]1C[C@H]1/N=C(\N)Nc1cccc(C(C)C)c1.I |
| InChI | InChI=1S/C15H23N3.HI/c1-4-11-9-14(11)18-15(16)17-13-7-5-6-12(8-13)10(2)3;/h5-8,10-11,14H,4,9H2,1-3H3,(H3,16,17,18);1H/t11-,14-;/m1./s1 |
| InChIKey | VIQHHFNFEDZMCI-GBWFEORMSA-N |
| XLogP | 3.95 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|