C32H39N5 — CID 140939089
N-[2-(4-benzylpiperazin-1-yl)ethyl]-1-[3-(1H-indol-2-yl)phenyl]piperidin-4-amine (PubChem CID 140939089) has the molecular formula C32H39N5 and a molecular weight of 493.70 g/mol. Its IUPAC name is N-[2-(4-benzylpiperazin-1-yl)ethyl]-1-[3-(1H-indol-2-yl)phenyl]piperidin-4-amine.
| Compound Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-1-[3-(1H-indol-2-yl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 140939089 |
| Molecular Formula | C32H39N5 |
| Molecular Weight | 493.70 g/mol |
| Exact Mass | 493.32 |
| IUPAC Name | N-[2-(4-benzylpiperazin-1-yl)ethyl]-1-[3-(1H-indol-2-yl)phenyl]piperidin-4-amine |
| SMILES | c1ccc(CN2CCN(CCNC3CCN(c4cccc(-c5cc6ccccc6[nH]5)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C32H39N5/c1-2-7-26(8-3-1)25-36-21-19-35(20-22-36)18-15-33-29-13-16-37(17-14-29)30-11-6-10-27(23-30)32-24-28-9-4-5-12-31(28)34-32/h1-12,23-24,29,33-34H,13-22,25H2 |
| InChIKey | HXXWFJHFHZROCP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 37.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |