C28H36N4 — CID 140939103
2-[3-[4-[2-(4-propan-2-ylpiperazin-1-yl)ethylidene]piperidin-1-yl]phenyl]-1H-indole (PubChem CID 140939103) has the molecular formula C28H36N4 and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-[3-[4-[2-(4-propan-2-ylpiperazin-1-yl)ethylidene]piperidin-1-yl]phenyl]-1H-indole.
| Compound Name | 2-[3-[4-[2-(4-propan-2-ylpiperazin-1-yl)ethylidene]piperidin-1-yl]phenyl]-1H-indole |
|---|---|
| PubChem CID | 140939103 |
| Molecular Formula | C28H36N4 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 2-[3-[4-[2-(4-propan-2-ylpiperazin-1-yl)ethylidene]piperidin-1-yl]phenyl]-1H-indole |
| SMILES | CC(C)N1CCN(CC=C2CCN(c3cccc(-c4cc5ccccc5[nH]4)c3)CC2)CC1 |
| InChI | InChI=1S/C28H36N4/c1-22(2)31-18-16-30(17-19-31)13-10-23-11-14-32(15-12-23)26-8-5-7-24(20-26)28-21-25-6-3-4-9-27(25)29-28/h3-10,20-22,29H,11-19H2,1-2H3 |
| InChIKey | VWIVQMXQYGDGLZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 25.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|