C27H37N5 — CID 140939060
1-[3-(1H-indol-2-yl)phenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidin-4-amine (PubChem CID 140939060) has the molecular formula C27H37N5 and a molecular weight of 431.63 g/mol. Its IUPAC name is 1-[3-(1H-indol-2-yl)phenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidin-4-amine.
| Compound Name | 1-[3-(1H-indol-2-yl)phenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidin-4-amine |
|---|---|
| PubChem CID | 140939060 |
| Molecular Formula | C27H37N5 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | 1-[3-(1H-indol-2-yl)phenyl]-N-[3-(4-methylpiperazin-1-yl)propyl]piperidin-4-amine |
| SMILES | CN1CCN(CCCNC2CCN(c3cccc(-c4cc5ccccc5[nH]4)c3)CC2)CC1 |
| InChI | InChI=1S/C27H37N5/c1-30-16-18-31(19-17-30)13-5-12-28-24-10-14-32(15-11-24)25-8-4-7-22(20-25)27-21-23-6-2-3-9-26(23)29-27/h2-4,6-9,20-21,24,28-29H,5,10-19H2,1H3 |
| InChIKey | KVOBCFKUQMHVSH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|