C25H31FN4 — CID 140939169
N-[1-[3-(5-fluoro-1H-indol-2-yl)phenyl]piperidin-4-yl]-1-methylpiperidin-4-amine (PubChem CID 140939169) has the molecular formula C25H31FN4 and a molecular weight of 406.55 g/mol. Its IUPAC name is N-[1-[3-(5-fluoro-1H-indol-2-yl)phenyl]piperidin-4-yl]-1-methylpiperidin-4-amine.
| Compound Name | N-[1-[3-(5-fluoro-1H-indol-2-yl)phenyl]piperidin-4-yl]-1-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 140939169 |
| Molecular Formula | C25H31FN4 |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | N-[1-[3-(5-fluoro-1H-indol-2-yl)phenyl]piperidin-4-yl]-1-methylpiperidin-4-amine |
| SMILES | CN1CCC(NC2CCN(c3cccc(-c4cc5cc(F)ccc5[nH]4)c3)CC2)CC1 |
| InChI | InChI=1S/C25H31FN4/c1-29-11-7-21(8-12-29)27-22-9-13-30(14-10-22)23-4-2-3-18(16-23)25-17-19-15-20(26)5-6-24(19)28-25/h2-6,15-17,21-22,27-28H,7-14H2,1H3 |
| InChIKey | DWZSJRUNGSWIKX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |