C24H30N4 — CID 140939131
2-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-1H-indole (PubChem CID 140939131) has the molecular formula C24H30N4 and a molecular weight of 374.53 g/mol. Its IUPAC name is 2-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-1H-indole.
| Compound Name | 2-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-1H-indole |
|---|---|
| PubChem CID | 140939131 |
| Molecular Formula | C24H30N4 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 2-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-1H-indole |
| SMILES | CN1CCN(C2CCN(c3cccc(-c4cc5ccccc5[nH]4)c3)CC2)CC1 |
| InChI | InChI=1S/C24H30N4/c1-26-13-15-28(16-14-26)21-9-11-27(12-10-21)22-7-4-6-19(17-22)24-18-20-5-2-3-8-23(20)25-24/h2-8,17-18,21,25H,9-16H2,1H3 |
| InChIKey | HYFMNUUNCPTZBO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 25.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |