C25H26N4 — CID 146536104
1-[3-(1H-indol-2-yl)phenyl]-N-(pyridin-4-ylmethyl)piperidin-4-amine (PubChem CID 146536104) has the molecular formula C25H26N4 and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-[3-(1H-indol-2-yl)phenyl]-N-(pyridin-4-ylmethyl)piperidin-4-amine.
| Compound Name | 1-[3-(1H-indol-2-yl)phenyl]-N-(pyridin-4-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 146536104 |
| Molecular Formula | C25H26N4 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-[3-(1H-indol-2-yl)phenyl]-N-(pyridin-4-ylmethyl)piperidin-4-amine |
| SMILES | c1cc(-c2cc3ccccc3[nH]2)cc(N2CCC(NCc3ccncc3)CC2)c1 |
| InChI | InChI=1S/C25H26N4/c1-2-7-24-21(4-1)17-25(28-24)20-5-3-6-23(16-20)29-14-10-22(11-15-29)27-18-19-8-12-26-13-9-19/h1-9,12-13,16-17,22,27-28H,10-11,14-15,18H2 |
| InChIKey | HWFYSRHTZAHUSV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |