C20H22N6O2 — CID 167804937
(5S)-3-[3-(1H-benzimidazol-2-yl)cyclohexyl]-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione (PubChem CID 167804937) has the molecular formula C20H22N6O2 and a molecular weight of 378.44 g/mol. Its IUPAC name is (5S)-3-[3-(1H-benzimidazol-2-yl)cyclohexyl]-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[3-(1H-benzimidazol-2-yl)cyclohexyl]-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167804937 |
| Molecular Formula | C20H22N6O2 |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (5S)-3-[3-(1H-benzimidazol-2-yl)cyclohexyl]-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@@H](Cc2cnc[nH]2)C(=O)N1C1CCCC(c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C20H22N6O2/c27-19-17(9-13-10-21-11-22-13)25-20(28)26(19)14-5-3-4-12(8-14)18-23-15-6-1-2-7-16(15)24-18/h1-2,6-7,10-12,14,17H,3-5,8-9H2,(H,21,22)(H,23,24)(H,25,28)/t12?,14?,17-/m0/s1 |
| InChIKey | WHYDFSNZYRZOTF-AJUCZRQESA-N |
| XLogP | 2.48 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|