C19H19ClN4O — CID 86638539
N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-6-chloropyridine-3-carboxamide (PubChem CID 86638539) has the molecular formula C19H19ClN4O and a molecular weight of 354.84 g/mol. Its IUPAC name is N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-6-chloropyridine-3-carboxamide.
| Compound Name | N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-6-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 86638539 |
| Molecular Formula | C19H19ClN4O |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-6-chloropyridine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@H](c2nc3ccccc3[nH]2)C1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H19ClN4O/c20-17-9-8-13(11-21-17)19(25)22-14-5-3-4-12(10-14)18-23-15-6-1-2-7-16(15)24-18/h1-2,6-9,11-12,14H,3-5,10H2,(H,22,25)(H,23,24)/t12-,14+/m0/s1 |
| InChIKey | NIJMWODYNQOHPH-GXTWGEPZSA-N |
| XLogP | 4.07 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|