C25H35N5O — CID 143700070
N-[3-(1H-benzimidazol-2-yl)cyclohexyl]-4-(ethylamino)-3-(methylamino)benzamide;ethane (PubChem CID 143700070) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)cyclohexyl]-4-(ethylamino)-3-(methylamino)benzamide;ethane.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)cyclohexyl]-4-(ethylamino)-3-(methylamino)benzamide;ethane |
|---|---|
| PubChem CID | 143700070 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)cyclohexyl]-4-(ethylamino)-3-(methylamino)benzamide;ethane |
| SMILES | CC.CCNc1ccc(C(=O)NC2CCCC(c3nc4ccccc4[nH]3)C2)cc1NC |
| InChI | InChI=1S/C23H29N5O.C2H6/c1-3-25-18-12-11-16(14-21(18)24-2)23(29)26-17-8-6-7-15(13-17)22-27-19-9-4-5-10-20(19)28-22;1-2/h4-5,9-12,14-15,17,24-25H,3,6-8,13H2,1-2H3,(H,26,29)(H,27,28);1-2H3 |
| InChIKey | BXLVIYOFYPVEJV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |