C20H20Cl2N4O — CID 59175073
1-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-3-(2,4-dichlorophenyl)urea (PubChem CID 59175073) has the molecular formula C20H20Cl2N4O and a molecular weight of 403.31 g/mol. Its IUPAC name is 1-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 59175073 |
| Molecular Formula | C20H20Cl2N4O |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 1-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-3-(2,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)N[C@@H]1CCC[C@H](c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C20H20Cl2N4O/c21-13-8-9-16(15(22)11-13)26-20(27)23-14-5-3-4-12(10-14)19-24-17-6-1-2-7-18(17)25-19/h1-2,6-9,11-12,14H,3-5,10H2,(H,24,25)(H2,23,26,27)/t12-,14+/m0/s1 |
| InChIKey | CHSNIDBTAMZXTP-GXTWGEPZSA-N |
| XLogP | 5.72 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |