C24H24N4OS — CID 71095705
1-[3-(1H-benzimidazol-2-yl)cyclohexyl]-3-(5-phenylthiophen-2-yl)urea (PubChem CID 71095705) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is 1-[3-(1H-benzimidazol-2-yl)cyclohexyl]-3-(5-phenylthiophen-2-yl)urea.
| Compound Name | 1-[3-(1H-benzimidazol-2-yl)cyclohexyl]-3-(5-phenylthiophen-2-yl)urea |
|---|---|
| PubChem CID | 71095705 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[3-(1H-benzimidazol-2-yl)cyclohexyl]-3-(5-phenylthiophen-2-yl)urea |
| SMILES | O=C(Nc1ccc(-c2ccccc2)s1)NC1CCCC(c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C24H24N4OS/c29-24(28-22-14-13-21(30-22)16-7-2-1-3-8-16)25-18-10-6-9-17(15-18)23-26-19-11-4-5-12-20(19)27-23/h1-5,7-8,11-14,17-18H,6,9-10,15H2,(H,26,27)(H2,25,28,29) |
| InChIKey | ZBQFZECMXBZYKJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |