C12H17Cl2N3 — CID 131870823
2-[(3S)-piperidin-3-yl]-1H-benzimidazole;dihydrochloride (PubChem CID 131870823) has the molecular formula C12H17Cl2N3 and a molecular weight of 274.19 g/mol. Its IUPAC name is 2-[(3S)-piperidin-3-yl]-1H-benzimidazole;dihydrochloride.
| Compound Name | 2-[(3S)-piperidin-3-yl]-1H-benzimidazole;dihydrochloride |
|---|---|
| PubChem CID | 131870823 |
| Molecular Formula | C12H17Cl2N3 |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[(3S)-piperidin-3-yl]-1H-benzimidazole;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2[nH]c([C@H]3CCCNC3)nc2c1 |
| InChI | InChI=1S/C12H15N3.2ClH/c1-2-6-11-10(5-1)14-12(15-11)9-4-3-7-13-8-9;;/h1-2,5-6,9,13H,3-4,7-8H2,(H,14,15);2*1H/t9-;;/m0../s1 |
| InChIKey | CFPREZCBLXSHFZ-WWPIYYJJSA-N |
| XLogP | 2.87 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |