C17H25N5 — CID 83949259
6-(piperazin-1-ylmethyl)-2-piperidin-3-yl-1H-benzimidazole (PubChem CID 83949259) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 6-(piperazin-1-ylmethyl)-2-piperidin-3-yl-1H-benzimidazole.
| Compound Name | 6-(piperazin-1-ylmethyl)-2-piperidin-3-yl-1H-benzimidazole |
|---|---|
| PubChem CID | 83949259 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 6-(piperazin-1-ylmethyl)-2-piperidin-3-yl-1H-benzimidazole |
| SMILES | c1cc2nc(C3CCCNC3)[nH]c2cc1CN1CCNCC1 |
| InChI | InChI=1S/C17H25N5/c1-2-14(11-19-5-1)17-20-15-4-3-13(10-16(15)21-17)12-22-8-6-18-7-9-22/h3-4,10,14,18-19H,1-2,5-9,11-12H2,(H,20,21) |
| InChIKey | BOQZATILUFQBHB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |