C16H21N3 — CID 117391858
2-cyclopropyl-6-(piperidin-3-ylmethyl)-1H-benzimidazole (PubChem CID 117391858) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is 2-cyclopropyl-6-(piperidin-3-ylmethyl)-1H-benzimidazole.
| Compound Name | 2-cyclopropyl-6-(piperidin-3-ylmethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 117391858 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-cyclopropyl-6-(piperidin-3-ylmethyl)-1H-benzimidazole |
| SMILES | c1cc2nc(C3CC3)[nH]c2cc1CC1CCCNC1 |
| InChI | InChI=1S/C16H21N3/c1-2-12(10-17-7-1)8-11-3-6-14-15(9-11)19-16(18-14)13-4-5-13/h3,6,9,12-13,17H,1-2,4-5,7-8,10H2,(H,18,19) |
| InChIKey | ZSBNHFRAUIZOLI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |