C14H18N4OS — CID 84816446
2-[(2-piperidin-3-yl-3H-benzimidazol-5-yl)oxy]ethanethioamide (PubChem CID 84816446) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-[(2-piperidin-3-yl-3H-benzimidazol-5-yl)oxy]ethanethioamide.
| Compound Name | 2-[(2-piperidin-3-yl-3H-benzimidazol-5-yl)oxy]ethanethioamide |
|---|---|
| PubChem CID | 84816446 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-[(2-piperidin-3-yl-3H-benzimidazol-5-yl)oxy]ethanethioamide |
| SMILES | NC(=S)COc1ccc2nc(C3CCCNC3)[nH]c2c1 |
| InChI | InChI=1S/C14H18N4OS/c15-13(20)8-19-10-3-4-11-12(6-10)18-14(17-11)9-2-1-5-16-7-9/h3-4,6,9,16H,1-2,5,7-8H2,(H2,15,20)(H,17,18) |
| InChIKey | ZROUFTZAPWOCOE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|