C16H18ClN5O2S — CID 133123327
(7R,9aS)-2-[(5-chlorothiophen-2-yl)methyl]-7-(1H-imidazol-5-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 133123327) has the molecular formula C16H18ClN5O2S and a molecular weight of 379.87 g/mol. Its IUPAC name is (7R,9aS)-2-[(5-chlorothiophen-2-yl)methyl]-7-(1H-imidazol-5-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7R,9aS)-2-[(5-chlorothiophen-2-yl)methyl]-7-(1H-imidazol-5-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 133123327 |
| Molecular Formula | C16H18ClN5O2S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | (7R,9aS)-2-[(5-chlorothiophen-2-yl)methyl]-7-(1H-imidazol-5-ylmethyl)-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1N[C@H](Cc2cnc[nH]2)C(=O)N2CCN(Cc3ccc(Cl)s3)C[C@@H]12 |
| InChI | InChI=1S/C16H18ClN5O2S/c17-14-2-1-11(25-14)7-21-3-4-22-13(8-21)15(23)20-12(16(22)24)5-10-6-18-9-19-10/h1-2,6,9,12-13H,3-5,7-8H2,(H,18,19)(H,20,23)/t12-,13+/m1/s1 |
| InChIKey | GHDWEOYKAYLPAO-OLZOCXBDSA-N |
| XLogP | 0.88 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |