C25H31ClN4O2S — CID 131915968
(7S,9aR)-7-[(4-chlorophenyl)methyl]-2-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 131915968) has the molecular formula C25H31ClN4O2S and a molecular weight of 487.07 g/mol. Its IUPAC name is (7S,9aR)-7-[(4-chlorophenyl)methyl]-2-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-[(4-chlorophenyl)methyl]-2-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 131915968 |
| Molecular Formula | C25H31ClN4O2S |
| Molecular Weight | 487.07 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (7S,9aR)-7-[(4-chlorophenyl)methyl]-2-[[5-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | O=C1N[C@@H](Cc2ccc(Cl)cc2)C(=O)N2CCN(Cc3ccc(CN4CCCCC4)s3)C[C@H]12 |
| InChI | InChI=1S/C25H31ClN4O2S/c26-19-6-4-18(5-7-19)14-22-25(32)30-13-12-29(17-23(30)24(31)27-22)16-21-9-8-20(33-21)15-28-10-2-1-3-11-28/h4-9,22-23H,1-3,10-17H2,(H,27,31)/t22-,23+/m0/s1 |
| InChIKey | HBCSLHSRHXMTTE-XZOQPEGZSA-N |
| XLogP | 3.14 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.07 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |