C15H21N3O2S — CID 56855888
(7S,9aR)-7-ethyl-2-[(5-methylthiophen-2-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56855888) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is (7S,9aR)-7-ethyl-2-[(5-methylthiophen-2-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-ethyl-2-[(5-methylthiophen-2-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56855888 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (7S,9aR)-7-ethyl-2-[(5-methylthiophen-2-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC[C@@H]1NC(=O)[C@H]2CN(Cc3ccc(C)s3)CCN2C1=O |
| InChI | InChI=1S/C15H21N3O2S/c1-3-12-15(20)18-7-6-17(9-13(18)14(19)16-12)8-11-5-4-10(2)21-11/h4-5,12-13H,3,6-9H2,1-2H3,(H,16,19)/t12-,13+/m0/s1 |
| InChIKey | QCAUVXATTBYPJG-QWHCGFSZSA-N |
| XLogP | 0.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |