C21H22FN3O4 — CID 42962374
3-[1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide (PubChem CID 42962374) has the molecular formula C21H22FN3O4 and a molecular weight of 399.42 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide.
| Compound Name | 3-[1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 42962374 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-[1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(4-methoxyphenyl)ethyl]propanamide |
| SMILES | COc1ccc(CCNC(=O)CCC2NC(=O)N(c3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H22FN3O4/c1-29-17-8-2-14(3-9-17)12-13-23-19(26)11-10-18-20(27)25(21(28)24-18)16-6-4-15(22)5-7-16/h2-9,18H,10-13H2,1H3,(H,23,26)(H,24,28) |
| InChIKey | HVLLLCKLPWBZBM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|