C19H24N4O5 — CID 110204751
3-[(4S)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(2-oxopyrrolidin-1-yl)ethyl]propanamide (PubChem CID 110204751) has the molecular formula C19H24N4O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-[(4S)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(2-oxopyrrolidin-1-yl)ethyl]propanamide.
| Compound Name | 3-[(4S)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(2-oxopyrrolidin-1-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 110204751 |
| Molecular Formula | C19H24N4O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 3-[(4S)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-[2-(2-oxopyrrolidin-1-yl)ethyl]propanamide |
| SMILES | COc1ccc(N2C(=O)N[C@@H](CCC(=O)NCCN3CCCC3=O)C2=O)cc1 |
| InChI | InChI=1S/C19H24N4O5/c1-28-14-6-4-13(5-7-14)23-18(26)15(21-19(23)27)8-9-16(24)20-10-12-22-11-2-3-17(22)25/h4-7,15H,2-3,8-12H2,1H3,(H,20,24)(H,21,27)/t15-/m0/s1 |
| InChIKey | CRRFMXFIZNOZQX-HNNXBMFYSA-N |
| XLogP | 0.64 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|