C19H22N4O4 — CID 91823348
3-[1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-[(1-methylpyrrol-2-yl)methyl]propanamide (PubChem CID 91823348) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-[1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-[(1-methylpyrrol-2-yl)methyl]propanamide.
| Compound Name | 3-[1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-[(1-methylpyrrol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 91823348 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-[(1-methylpyrrol-2-yl)methyl]propanamide |
| SMILES | COc1ccc(N2C(=O)NC(CCC(=O)NCc3cccn3C)C2=O)cc1 |
| InChI | InChI=1S/C19H22N4O4/c1-22-11-3-4-14(22)12-20-17(24)10-9-16-18(25)23(19(26)21-16)13-5-7-15(27-2)8-6-13/h3-8,11,16H,9-10,12H2,1-2H3,(H,20,24)(H,21,26) |
| InChIKey | SVMXTTUDALIQED-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|