C18H21N5O4 — CID 124849525
3-[(4R)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(2-pyrazol-1-ylethyl)propanamide (PubChem CID 124849525) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 3-[(4R)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(2-pyrazol-1-ylethyl)propanamide.
| Compound Name | 3-[(4R)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(2-pyrazol-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 124849525 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 3-[(4R)-1-(4-methoxyphenyl)-2,5-dioxoimidazolidin-4-yl]-N-(2-pyrazol-1-ylethyl)propanamide |
| SMILES | COc1ccc(N2C(=O)N[C@H](CCC(=O)NCCn3cccn3)C2=O)cc1 |
| InChI | InChI=1S/C18H21N5O4/c1-27-14-5-3-13(4-6-14)23-17(25)15(21-18(23)26)7-8-16(24)19-10-12-22-11-2-9-20-22/h2-6,9,11,15H,7-8,10,12H2,1H3,(H,19,24)(H,21,26)/t15-/m1/s1 |
| InChIKey | OURSNOBNCREMFW-OAHLLOKOSA-N |
| XLogP | 0.91 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|