C16H21Cl2N3O2 — CID 120944201
N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-methylquinoline-4-carboxamide;dihydrochloride (PubChem CID 120944201) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-methylquinoline-4-carboxamide;dihydrochloride.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-methylquinoline-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120944201 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-methylquinoline-4-carboxamide;dihydrochloride |
| SMILES | Cc1cc(C(=O)NCC2CNCC2O)c2ccccc2n1.Cl.Cl |
| InChI | InChI=1S/C16H19N3O2.2ClH/c1-10-6-13(12-4-2-3-5-14(12)19-10)16(21)18-8-11-7-17-9-15(11)20;;/h2-6,11,15,17,20H,7-9H2,1H3,(H,18,21);2*1H |
| InChIKey | MJHQFIIXXWSQON-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |