C16H21N3O3S — CID 46993368
N-[2-(dimethylsulfamoyl)ethyl]-2,8-dimethylquinoline-4-carboxamide (PubChem CID 46993368) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-2,8-dimethylquinoline-4-carboxamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-2,8-dimethylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 46993368 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-2,8-dimethylquinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCS(=O)(=O)N(C)C)c2cccc(C)c2n1 |
| InChI | InChI=1S/C16H21N3O3S/c1-11-6-5-7-13-14(10-12(2)18-15(11)13)16(20)17-8-9-23(21,22)19(3)4/h5-7,10H,8-9H2,1-4H3,(H,17,20) |
| InChIKey | VATCNQHYMLTEEO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |