C11H16N2O5S — CID 106339701
N-[2-(dimethylsulfamoyl)ethyl]-2,3-dihydroxybenzamide (PubChem CID 106339701) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-2,3-dihydroxybenzamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-2,3-dihydroxybenzamide |
|---|---|
| PubChem CID | 106339701 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-2,3-dihydroxybenzamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C11H16N2O5S/c1-13(2)19(17,18)7-6-12-11(16)8-4-3-5-9(14)10(8)15/h3-5,14-15H,6-7H2,1-2H3,(H,12,16) |
| InChIKey | VNXGMIHYKLUOPV-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|