C12H20N4O3S — CID 106340952
N-[2-(dimethylsulfamoyl)ethyl]-2-hydrazinyl-4-methylbenzamide (PubChem CID 106340952) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-2-hydrazinyl-4-methylbenzamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-2-hydrazinyl-4-methylbenzamide |
|---|---|
| PubChem CID | 106340952 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-2-hydrazinyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCS(=O)(=O)N(C)C)c(NN)c1 |
| InChI | InChI=1S/C12H20N4O3S/c1-9-4-5-10(11(8-9)15-13)12(17)14-6-7-20(18,19)16(2)3/h4-5,8,15H,6-7,13H2,1-3H3,(H,14,17) |
| InChIKey | PDGVQGSLZMWQML-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|