C17H19N5O — CID 99797044
(2R)-N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-phenyl-2-(tetrazol-1-yl)acetamide (PubChem CID 99797044) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is (2R)-N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-phenyl-2-(tetrazol-1-yl)acetamide.
| Compound Name | (2R)-N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-phenyl-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 99797044 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | (2R)-N-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-phenyl-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(NC[C@H]1C[C@H]2C=C[C@@H]1C2)[C@@H](c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C17H19N5O/c23-17(18-10-15-9-12-6-7-14(15)8-12)16(22-11-19-20-21-22)13-4-2-1-3-5-13/h1-7,11-12,14-16H,8-10H2,(H,18,23)/t12-,14+,15+,16+/m0/s1 |
| InChIKey | HHYGYMQXGYDRPP-LCGIIJARSA-N |
| XLogP | 1.59 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|