C17H19N7O — CID 125444082
(2S)-N-[[1-(imidazol-1-ylmethyl)cyclopropyl]methyl]-2-phenyl-2-(tetrazol-1-yl)acetamide (PubChem CID 125444082) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is (2S)-N-[[1-(imidazol-1-ylmethyl)cyclopropyl]methyl]-2-phenyl-2-(tetrazol-1-yl)acetamide.
| Compound Name | (2S)-N-[[1-(imidazol-1-ylmethyl)cyclopropyl]methyl]-2-phenyl-2-(tetrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 125444082 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (2S)-N-[[1-(imidazol-1-ylmethyl)cyclopropyl]methyl]-2-phenyl-2-(tetrazol-1-yl)acetamide |
| SMILES | O=C(NCC1(Cn2ccnc2)CC1)[C@H](c1ccccc1)n1cnnn1 |
| InChI | InChI=1S/C17H19N7O/c25-16(19-10-17(6-7-17)11-23-9-8-18-12-23)15(24-13-20-21-22-24)14-4-2-1-3-5-14/h1-5,8-9,12-13,15H,6-7,10-11H2,(H,19,25)/t15-/m0/s1 |
| InChIKey | USZZXOAQYNKJSI-HNNXBMFYSA-N |
| XLogP | 1.06 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |