C19H22N2O2 — CID 99794235
N-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(5-methoxyindol-1-yl)acetamide (PubChem CID 99794235) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(5-methoxyindol-1-yl)acetamide.
| Compound Name | N-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(5-methoxyindol-1-yl)acetamide |
|---|---|
| PubChem CID | 99794235 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(5-methoxyindol-1-yl)acetamide |
| SMILES | COc1ccc2c(ccn2CC(=O)NC[C@@H]2C[C@@H]3C=C[C@@H]2C3)c1 |
| InChI | InChI=1S/C19H22N2O2/c1-23-17-4-5-18-15(10-17)6-7-21(18)12-19(22)20-11-16-9-13-2-3-14(16)8-13/h2-7,10,13-14,16H,8-9,11-12H2,1H3,(H,20,22)/t13-,14-,16+/m1/s1 |
| InChIKey | DJPMZRBXISOHDD-FMKPAKJESA-N |
| XLogP | 2.98 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|