C20H30N4O2 — CID 124926213
1-N',4-N'-bis[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]butanedihydrazide (PubChem CID 124926213) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 1-N',4-N'-bis[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]butanedihydrazide.
| Compound Name | 1-N',4-N'-bis[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]butanedihydrazide |
|---|---|
| PubChem CID | 124926213 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 1-N',4-N'-bis[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]butanedihydrazide |
| SMILES | O=C(CCC(=O)NNC[C@@H]1C[C@H]2C=C[C@H]1C2)NNC[C@@H]1C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C20H30N4O2/c25-19(23-21-11-17-9-13-1-3-15(17)7-13)5-6-20(26)24-22-12-18-10-14-2-4-16(18)8-14/h1-4,13-18,21-22H,5-12H2,(H,23,25)(H,24,26)/t13-,14-,15-,16-,17-,18-/m0/s1 |
| InChIKey | HALFTDQUGCSREB-QQCJEOGWSA-N |
| XLogP | 1.43 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|