C26H35N3O2 — CID 22966073
1-(3-acetylphenyl)-3-[3-[(2R,4S)-4-benzyl-1-ethylpiperidin-2-yl]propyl]urea (PubChem CID 22966073) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[3-[(2R,4S)-4-benzyl-1-ethylpiperidin-2-yl]propyl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[3-[(2R,4S)-4-benzyl-1-ethylpiperidin-2-yl]propyl]urea |
|---|---|
| PubChem CID | 22966073 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[3-[(2R,4S)-4-benzyl-1-ethylpiperidin-2-yl]propyl]urea |
| SMILES | CCN1CC[C@H](Cc2ccccc2)C[C@H]1CCCNC(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C26H35N3O2/c1-3-29-16-14-22(17-21-9-5-4-6-10-21)18-25(29)13-8-15-27-26(31)28-24-12-7-11-23(19-24)20(2)30/h4-7,9-12,19,22,25H,3,8,13-18H2,1-2H3,(H2,27,28,31)/t22-,25-/m1/s1 |
| InChIKey | FMIQBMWPGVAXOF-RCZVLFRGSA-N |
| XLogP | 5.13 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|