C37H48N4O5 — CID 142000857
1-(3-acetylphenyl)-3-[3-[(4S)-4-benzyl-2-[(1S)-1-methoxypropyl]piperidin-1-yl]propyl]urea;N-(3-acetylphenyl)formamide (PubChem CID 142000857) has the molecular formula C37H48N4O5 and a molecular weight of 628.81 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[3-[(4S)-4-benzyl-2-[(1S)-1-methoxypropyl]piperidin-1-yl]propyl]urea;N-(3-acetylphenyl)formamide.
| Compound Name | 1-(3-acetylphenyl)-3-[3-[(4S)-4-benzyl-2-[(1S)-1-methoxypropyl]piperidin-1-yl]propyl]urea;N-(3-acetylphenyl)formamide |
|---|---|
| PubChem CID | 142000857 |
| Molecular Formula | C37H48N4O5 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.36 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[3-[(4S)-4-benzyl-2-[(1S)-1-methoxypropyl]piperidin-1-yl]propyl]urea;N-(3-acetylphenyl)formamide |
| SMILES | CC(=O)c1cccc(NC=O)c1.CC[C@H](OC)C1C[C@@H](Cc2ccccc2)CCN1CCCNC(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C28H39N3O3.C9H9NO2/c1-4-27(34-3)26-19-23(18-22-10-6-5-7-11-22)14-17-31(26)16-9-15-29-28(33)30-25-13-8-12-24(20-25)21(2)32;1-7(12)8-3-2-4-9(5-8)10-6-11/h5-8,10-13,20,23,26-27H,4,9,14-19H2,1-3H3,(H2,29,30,33);2-6H,1H3,(H,10,11)/t23-,26?,27+;/m1./s1 |
| InChIKey | CVJGMEJCIKRNSR-VPJNNNQLSA-N |
| XLogP | 6.61 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|