C28H37FN3O2+ — CID 18433235
1-(3-acetylphenyl)-3-[3-[1-(cyclopropylmethyl)-4-[(4-fluorophenyl)methyl]piperidin-1-ium-1-yl]propyl]urea (PubChem CID 18433235) has the molecular formula C28H37FN3O2+ and a molecular weight of 466.62 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[3-[1-(cyclopropylmethyl)-4-[(4-fluorophenyl)methyl]piperidin-1-ium-1-yl]propyl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[3-[1-(cyclopropylmethyl)-4-[(4-fluorophenyl)methyl]piperidin-1-ium-1-yl]propyl]urea |
|---|---|
| PubChem CID | 18433235 |
| Molecular Formula | C28H37FN3O2+ |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[3-[1-(cyclopropylmethyl)-4-[(4-fluorophenyl)methyl]piperidin-1-ium-1-yl]propyl]urea |
| SMILES | CC(=O)c1cccc(NC(=O)NCCC[N+]2(CC3CC3)CCC(Cc3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C28H36FN3O2/c1-21(33)25-4-2-5-27(19-25)31-28(34)30-14-3-15-32(20-24-6-7-24)16-12-23(13-17-32)18-22-8-10-26(29)11-9-22/h2,4-5,8-11,19,23-24H,3,6-7,12-18,20H2,1H3,(H-,30,31,34)/p+1 |
| InChIKey | NFAWKZLINGXFIJ-UHFFFAOYSA-O |
| XLogP | 5.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|