C29H37FN3O4+ — CID 18433311
1-(3,5-diacetylphenyl)-3-[3-[4-[(4-fluorophenyl)methyl]-1-(2-oxopropyl)piperidin-1-ium-1-yl]propyl]urea (PubChem CID 18433311) has the molecular formula C29H37FN3O4+ and a molecular weight of 510.63 g/mol. Its IUPAC name is 1-(3,5-diacetylphenyl)-3-[3-[4-[(4-fluorophenyl)methyl]-1-(2-oxopropyl)piperidin-1-ium-1-yl]propyl]urea.
| Compound Name | 1-(3,5-diacetylphenyl)-3-[3-[4-[(4-fluorophenyl)methyl]-1-(2-oxopropyl)piperidin-1-ium-1-yl]propyl]urea |
|---|---|
| PubChem CID | 18433311 |
| Molecular Formula | C29H37FN3O4+ |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 1-(3,5-diacetylphenyl)-3-[3-[4-[(4-fluorophenyl)methyl]-1-(2-oxopropyl)piperidin-1-ium-1-yl]propyl]urea |
| SMILES | CC(=O)C[N+]1(CCCNC(=O)Nc2cc(C(C)=O)cc(C(C)=O)c2)CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H36FN3O4/c1-20(34)19-33(13-9-24(10-14-33)15-23-5-7-27(30)8-6-23)12-4-11-31-29(37)32-28-17-25(21(2)35)16-26(18-28)22(3)36/h5-8,16-18,24H,4,9-15,19H2,1-3H3,(H-,31,32,37)/p+1 |
| InChIKey | MAYOWDGZEOFCRK-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|