C30H37FN5O2+ — CID 18433226
1-cyano-3-(3,5-diacetylphenyl)-2-[3-[4-[(4-fluorophenyl)methyl]-1-prop-2-enylpiperidin-1-ium-1-yl]propyl]guanidine (PubChem CID 18433226) has the molecular formula C30H37FN5O2+ and a molecular weight of 518.66 g/mol. Its IUPAC name is 1-cyano-3-(3,5-diacetylphenyl)-2-[3-[4-[(4-fluorophenyl)methyl]-1-prop-2-enylpiperidin-1-ium-1-yl]propyl]guanidine.
| Compound Name | 1-cyano-3-(3,5-diacetylphenyl)-2-[3-[4-[(4-fluorophenyl)methyl]-1-prop-2-enylpiperidin-1-ium-1-yl]propyl]guanidine |
|---|---|
| PubChem CID | 18433226 |
| Molecular Formula | C30H37FN5O2+ |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 1-cyano-3-(3,5-diacetylphenyl)-2-[3-[4-[(4-fluorophenyl)methyl]-1-prop-2-enylpiperidin-1-ium-1-yl]propyl]guanidine |
| SMILES | C=CC[N+]1(CCC/N=C(\NC#N)Nc2cc(C(C)=O)cc(C(C)=O)c2)CCC(Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C30H37FN5O2/c1-4-13-36(15-10-25(11-16-36)17-24-6-8-28(31)9-7-24)14-5-12-33-30(34-21-32)35-29-19-26(22(2)37)18-27(20-29)23(3)38/h4,6-9,18-20,25H,1,5,10-17H2,2-3H3,(H2,33,34,35)/q+1 |
| InChIKey | KBSDYXLIXONWFC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|