C27H30FN5O3 — CID 10278143
1-cyano-3-(3,5-diacetylphenyl)-2-[3-[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]-3-oxopropyl]guanidine (PubChem CID 10278143) has the molecular formula C27H30FN5O3 and a molecular weight of 491.57 g/mol. Its IUPAC name is 1-cyano-3-(3,5-diacetylphenyl)-2-[3-[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]-3-oxopropyl]guanidine.
| Compound Name | 1-cyano-3-(3,5-diacetylphenyl)-2-[3-[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]-3-oxopropyl]guanidine |
|---|---|
| PubChem CID | 10278143 |
| Molecular Formula | C27H30FN5O3 |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 1-cyano-3-(3,5-diacetylphenyl)-2-[3-[(3S)-3-[(4-fluorophenyl)methyl]piperidin-1-yl]-3-oxopropyl]guanidine |
| SMILES | CC(=O)c1cc(N/C(=N/CCC(=O)N2CCC[C@@H](Cc3ccc(F)cc3)C2)NC#N)cc(C(C)=O)c1 |
| InChI | InChI=1S/C27H30FN5O3/c1-18(34)22-13-23(19(2)35)15-25(14-22)32-27(31-17-29)30-10-9-26(36)33-11-3-4-21(16-33)12-20-5-7-24(28)8-6-20/h5-8,13-15,21H,3-4,9-12,16H2,1-2H3,(H2,30,31,32)/t21-/m0/s1 |
| InChIKey | UUNKLEHXLWYUBQ-NRFANRHFSA-N |
| XLogP | 3.94 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|