C22H26FN3O2 — CID 97444795
(3S)-N-[3-(ethylcarbamoyl)phenyl]-3-[(4-fluorophenyl)methyl]piperidine-1-carboxamide (PubChem CID 97444795) has the molecular formula C22H26FN3O2 and a molecular weight of 383.47 g/mol. Its IUPAC name is (3S)-N-[3-(ethylcarbamoyl)phenyl]-3-[(4-fluorophenyl)methyl]piperidine-1-carboxamide.
| Compound Name | (3S)-N-[3-(ethylcarbamoyl)phenyl]-3-[(4-fluorophenyl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97444795 |
| Molecular Formula | C22H26FN3O2 |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (3S)-N-[3-(ethylcarbamoyl)phenyl]-3-[(4-fluorophenyl)methyl]piperidine-1-carboxamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)N2CCC[C@@H](Cc3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C22H26FN3O2/c1-2-24-21(27)18-6-3-7-20(14-18)25-22(28)26-12-4-5-17(15-26)13-16-8-10-19(23)11-9-16/h3,6-11,14,17H,2,4-5,12-13,15H2,1H3,(H,24,27)(H,25,28)/t17-/m0/s1 |
| InChIKey | WBDQZWIGNKMTPN-KRWDZBQOSA-N |
| XLogP | 4.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |